
| English name: | Benflumetol | |
| CAS NO: | 82186-77-4 | |
| Molecular weight: | 528.9402 | |
| Molecular formula: | C30H32Cl3NO | |
| InChI: | InChI=1/C30H32Cl3NO/c1-3-5-13-34(14-6-4-2)19-29(35)28-18-23(33)17-27-25(15-20-7-9-21(31)10-8-20)26-16-22(32)11-12-24(26)30(27)28/h7-12,15-18,29,35H,3-6,13-14,19H2,1-2H3/b25-15- | |
| Structure: | ![]() |
|
| Last text:2,5-Dimethoxy-2,5-dihydrofuran, mixture ofcis and trans | Next text: atropine sulphate |
Add: Luohe City Chemical Park, Luohe, Henan, China.
P.C.: 462000
Contact: Zhang Jianwei +86-13903953077
Tel: +86-395-7133188 Fax: +86-395-7135789
Website: www.isabeldepaep.com E-mail: sales@meidikangchem.com
Luohe Meidikang Biological Technology Co.,Ltd. Copyright(C)2017 All Rights Reserved. Supported
ChemNet
ChinaChemNet
Toocle
Copyright Notice